C8H11N3O3S — CID 60816918
ethyl 2-[(4-methylthiadiazole-5-carbonyl)amino]acetate (PubChem CID 60816918) has the molecular formula C8H11N3O3S and a molecular weight of 229.26 g/mol. Its IUPAC name is ethyl 2-[(4-methylthiadiazole-5-carbonyl)amino]acetate.
| Compound Name | ethyl 2-[(4-methylthiadiazole-5-carbonyl)amino]acetate |
|---|---|
| PubChem CID | 60816918 |
| Molecular Formula | C8H11N3O3S |
| Molecular Weight | 229.26 g/mol |
| Exact Mass | 229.05 |
| IUPAC Name | ethyl 2-[(4-methylthiadiazole-5-carbonyl)amino]acetate |
| SMILES | CCOC(=O)CNC(=O)c1snnc1C |
| InChI | InChI=1S/C8H11N3O3S/c1-3-14-6(12)4-9-8(13)7-5(2)10-11-15-7/h3-4H2,1-2H3,(H,9,13) |
| InChIKey | KGAGDPFQSYZNQH-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.26 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |