C17H20FNO2 — CID 60816952
N-[(4-fluorophenyl)-phenylmethyl]-2,2-dimethoxyethanamine (PubChem CID 60816952) has the molecular formula C17H20FNO2 and a molecular weight of 289.35 g/mol. Its IUPAC name is N-[(4-fluorophenyl)-phenylmethyl]-2,2-dimethoxyethanamine.
| Compound Name | N-[(4-fluorophenyl)-phenylmethyl]-2,2-dimethoxyethanamine |
|---|---|
| PubChem CID | 60816952 |
| Molecular Formula | C17H20FNO2 |
| Molecular Weight | 289.35 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | N-[(4-fluorophenyl)-phenylmethyl]-2,2-dimethoxyethanamine |
| SMILES | COC(CNC(c1ccccc1)c1ccc(F)cc1)OC |
| InChI | InChI=1S/C17H20FNO2/c1-20-16(21-2)12-19-17(13-6-4-3-5-7-13)14-8-10-15(18)11-9-14/h3-11,16-17,19H,12H2,1-2H3 |
| InChIKey | YDNZNFDEMAZEPX-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.35 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|