C12H2F16 — CID 608175
1,3,3,4,4,5,5,6,6,8,9,10,11,11,12,12-hexadecafluorotricyclo[6.2.2.02,7]dodec-9-ene (PubChem CID 608175) has the molecular formula C12H2F16 and a molecular weight of 450.12 g/mol. Its IUPAC name is 1,3,3,4,4,5,5,6,6,8,9,10,11,11,12,12-hexadecafluorotricyclo[6.2.2.02,7]dodec-9-ene.
| Compound Name | 1,3,3,4,4,5,5,6,6,8,9,10,11,11,12,12-hexadecafluorotricyclo[6.2.2.02,7]dodec-9-ene |
|---|---|
| PubChem CID | 608175 |
| Molecular Formula | C12H2F16 |
| Molecular Weight | 450.12 g/mol |
| Exact Mass | 449.99 |
| IUPAC Name | 1,3,3,4,4,5,5,6,6,8,9,10,11,11,12,12-hexadecafluorotricyclo[6.2.2.02,7]dodec-9-ene |
| SMILES | FC1=C(F)C2(F)C3C(C(F)(F)C(F)(F)C(F)(F)C3(F)F)C1(F)C(F)(F)C2(F)F |
| InChI | InChI=1S/C12H2F16/c13-3-4(14)6(16)2-1(5(3,15)9(21,22)10(6,23)24)7(17,18)11(25,26)12(27,28)8(2,19)20/h1-2H |
| InChIKey | MQEZYWAICYZCHZ-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.12 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|