C15H15BrClN — CID 60818143
1-(3-bromophenyl)-2-(4-chlorophenyl)-N-methylethanamine (PubChem CID 60818143) has the molecular formula C15H15BrClN and a molecular weight of 324.65 g/mol. Its IUPAC name is 1-(3-bromophenyl)-2-(4-chlorophenyl)-N-methylethanamine.
| Compound Name | 1-(3-bromophenyl)-2-(4-chlorophenyl)-N-methylethanamine |
|---|---|
| PubChem CID | 60818143 |
| Molecular Formula | C15H15BrClN |
| Molecular Weight | 324.65 g/mol |
| Exact Mass | 323.01 |
| IUPAC Name | 1-(3-bromophenyl)-2-(4-chlorophenyl)-N-methylethanamine |
| SMILES | CNC(Cc1ccc(Cl)cc1)c1cccc(Br)c1 |
| InChI | InChI=1S/C15H15BrClN/c1-18-15(12-3-2-4-13(16)10-12)9-11-5-7-14(17)8-6-11/h2-8,10,15,18H,9H2,1H3 |
| InChIKey | ARFMJJOMKPANJD-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.65 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |