C14H12FN3OS — CID 60821186
4-(3-aminoprop-1-ynyl)-2-fluoro-N-(5-methyl-1,3-thiazol-2-yl)benzamide (PubChem CID 60821186) has the molecular formula C14H12FN3OS and a molecular weight of 289.34 g/mol. Its IUPAC name is 4-(3-aminoprop-1-ynyl)-2-fluoro-N-(5-methyl-1,3-thiazol-2-yl)benzamide.
| Compound Name | 4-(3-aminoprop-1-ynyl)-2-fluoro-N-(5-methyl-1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 60821186 |
| Molecular Formula | C14H12FN3OS |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | 4-(3-aminoprop-1-ynyl)-2-fluoro-N-(5-methyl-1,3-thiazol-2-yl)benzamide |
| SMILES | Cc1cnc(NC(=O)c2ccc(C#CCN)cc2F)s1 |
| InChI | InChI=1S/C14H12FN3OS/c1-9-8-17-14(20-9)18-13(19)11-5-4-10(3-2-6-16)7-12(11)15/h4-5,7-8H,6,16H2,1H3,(H,17,18,19) |
| InChIKey | LQXSHXFTYOEZLW-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|