C15H12FNO2S — CID 60821335
4-fluoro-2-(3-hydroxyprop-1-ynyl)-N-(thiophen-2-ylmethyl)benzamide (PubChem CID 60821335) has the molecular formula C15H12FNO2S and a molecular weight of 289.33 g/mol. Its IUPAC name is 4-fluoro-2-(3-hydroxyprop-1-ynyl)-N-(thiophen-2-ylmethyl)benzamide.
| Compound Name | 4-fluoro-2-(3-hydroxyprop-1-ynyl)-N-(thiophen-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 60821335 |
| Molecular Formula | C15H12FNO2S |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | 4-fluoro-2-(3-hydroxyprop-1-ynyl)-N-(thiophen-2-ylmethyl)benzamide |
| SMILES | O=C(NCc1cccs1)c1ccc(F)cc1C#CCO |
| InChI | InChI=1S/C15H12FNO2S/c16-12-5-6-14(11(9-12)3-1-7-18)15(19)17-10-13-4-2-8-20-13/h2,4-6,8-9,18H,7,10H2,(H,17,19) |
| InChIKey | KVDKWUVDCMVPLQ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|