C18H18N2O — CID 60821609
4-(3-aminoprop-1-ynyl)-N-(2,4-dimethylphenyl)benzamide (PubChem CID 60821609) has the molecular formula C18H18N2O and a molecular weight of 278.36 g/mol. Its IUPAC name is 4-(3-aminoprop-1-ynyl)-N-(2,4-dimethylphenyl)benzamide.
| Compound Name | 4-(3-aminoprop-1-ynyl)-N-(2,4-dimethylphenyl)benzamide |
|---|---|
| PubChem CID | 60821609 |
| Molecular Formula | C18H18N2O |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | 4-(3-aminoprop-1-ynyl)-N-(2,4-dimethylphenyl)benzamide |
| SMILES | Cc1ccc(NC(=O)c2ccc(C#CCN)cc2)c(C)c1 |
| InChI | InChI=1S/C18H18N2O/c1-13-5-10-17(14(2)12-13)20-18(21)16-8-6-15(7-9-16)4-3-11-19/h5-10,12H,11,19H2,1-2H3,(H,20,21) |
| InChIKey | VVAJHBGILRJAOK-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|