About 4-(3,5-difluoro-2-pyrrolidin-1-ylsulfonylphenyl)but-3-yn-1-ol
4-(3,5-difluoro-2-pyrrolidin-1-ylsulfonylphenyl)but-3-yn-1-ol (PubChem CID 60822546) has the molecular formula C14H15F2NO3S
and a molecular weight of 315.34 g/mol. Its IUPAC name is 4-(3,5-difluoro-2-pyrrolidin-1-ylsulfonylphenyl)but-3-yn-1-ol.
Molecular Properties
| Compound Name | 4-(3,5-difluoro-2-pyrrolidin-1-ylsulfonylphenyl)but-3-yn-1-ol |
| PubChem CID | 60822546 |
| Molecular Formula | C14H15F2NO3S |
| Molecular Weight | 315.34 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | 4-(3,5-difluoro-2-pyrrolidin-1-ylsulfonylphenyl)but-3-yn-1-ol |
| SMILES | O=S(=O)(c1c(F)cc(F)cc1C#CCCO)N1CCCC1 |
| InChI | InChI=1S/C14H15F2NO3S/c15-12-9-11(5-1-4-8-18)14(13(16)10-12)21(19,20)17-6-2-3-7-17/h9-10,18H,2-4,6-8H2 |
| InChIKey | NYKYXDGVBOFYLA-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.34 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(3,5-difluoro-2-pyrrolidin-1-ylsulfonylphenyl)but-3-yn-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,5-difluoro-2-pyrrolidin-1-ylsulfonylphenyl)but-3-yn-1-ol?
The IUPAC name of 4-(3,5-difluoro-2-pyrrolidin-1-ylsulfonylphenyl)but-3-yn-1-ol (CID 60822546) is 4-(3,5-difluoro-2-pyrrolidin-1-ylsulfonylphenyl)but-3-yn-1-ol.
What is the SMILES notation for 4-(3,5-difluoro-2-pyrrolidin-1-ylsulfonylphenyl)but-3-yn-1-ol?
The canonical SMILES for 4-(3,5-difluoro-2-pyrrolidin-1-ylsulfonylphenyl)but-3-yn-1-ol is O=S(=O)(c1c(F)cc(F)cc1C#CCCO)N1CCCC1.
What is the InChIKey of 4-(3,5-difluoro-2-pyrrolidin-1-ylsulfonylphenyl)but-3-yn-1-ol?
The InChIKey is NYKYXDGVBOFYLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15F2NO3S/c15-12-9-11(5-1-4-8-18)14(13(16)10-12)21(19,20)17-6-2-3-7-17/h9-10,18H,2-4,6-8H2.
What are the key properties of 4-(3,5-difluoro-2-pyrrolidin-1-ylsulfonylphenyl)but-3-yn-1-ol?
4-(3,5-difluoro-2-pyrrolidin-1-ylsulfonylphenyl)but-3-yn-1-ol has a molecular weight of 315.34 g/mol, XLogP of 1.48, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,5-difluoro-2-pyrrolidin-1-ylsulfonylphenyl)but-3-yn-1-ol is sourced from PubChem (CID 60822546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).