C14H13N3O3S — CID 60822605
N,N-bis(cyanomethyl)-2-(3-hydroxyprop-1-ynyl)-4-methylbenzenesulfonamide (PubChem CID 60822605) has the molecular formula C14H13N3O3S and a molecular weight of 303.34 g/mol. Its IUPAC name is N,N-bis(cyanomethyl)-2-(3-hydroxyprop-1-ynyl)-4-methylbenzenesulfonamide.
| Compound Name | N,N-bis(cyanomethyl)-2-(3-hydroxyprop-1-ynyl)-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 60822605 |
| Molecular Formula | C14H13N3O3S |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | N,N-bis(cyanomethyl)-2-(3-hydroxyprop-1-ynyl)-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(CC#N)CC#N)c(C#CCO)c1 |
| InChI | InChI=1S/C14H13N3O3S/c1-12-4-5-14(13(11-12)3-2-10-18)21(19,20)17(8-6-15)9-7-16/h4-5,11,18H,8-10H2,1H3 |
| InChIKey | QQTAUCPDPXSZTL-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 105.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|