C14H13BrFNO3S — CID 60823735
2-bromo-4-fluoro-N-(2-hydroxy-2-phenylethyl)benzenesulfonamide (PubChem CID 60823735) has the molecular formula C14H13BrFNO3S and a molecular weight of 374.23 g/mol. Its IUPAC name is 2-bromo-4-fluoro-N-(2-hydroxy-2-phenylethyl)benzenesulfonamide.
| Compound Name | 2-bromo-4-fluoro-N-(2-hydroxy-2-phenylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 60823735 |
| Molecular Formula | C14H13BrFNO3S |
| Molecular Weight | 374.23 g/mol |
| Exact Mass | 372.98 |
| IUPAC Name | 2-bromo-4-fluoro-N-(2-hydroxy-2-phenylethyl)benzenesulfonamide |
| SMILES | O=S(=O)(NCC(O)c1ccccc1)c1ccc(F)cc1Br |
| InChI | InChI=1S/C14H13BrFNO3S/c15-12-8-11(16)6-7-14(12)21(19,20)17-9-13(18)10-4-2-1-3-5-10/h1-8,13,17-18H,9H2 |
| InChIKey | DDDYXGGGFXZOCZ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.23 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |