C13H12N2O4S2 — CID 60823937
3-(3-hydroxyprop-1-ynyl)-4-methoxy-N-(1,3-thiazol-2-yl)benzenesulfonamide (PubChem CID 60823937) has the molecular formula C13H12N2O4S2 and a molecular weight of 324.38 g/mol. Its IUPAC name is 3-(3-hydroxyprop-1-ynyl)-4-methoxy-N-(1,3-thiazol-2-yl)benzenesulfonamide.
| Compound Name | 3-(3-hydroxyprop-1-ynyl)-4-methoxy-N-(1,3-thiazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 60823937 |
| Molecular Formula | C13H12N2O4S2 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.02 |
| IUPAC Name | 3-(3-hydroxyprop-1-ynyl)-4-methoxy-N-(1,3-thiazol-2-yl)benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2nccs2)cc1C#CCO |
| InChI | InChI=1S/C13H12N2O4S2/c1-19-12-5-4-11(9-10(12)3-2-7-16)21(17,18)15-13-14-6-8-20-13/h4-6,8-9,16H,7H2,1H3,(H,14,15) |
| InChIKey | ASUZGBXCRHKACO-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|