C12H11BrN2O2S — CID 60824838
2-bromo-4-methyl-N-pyridin-2-ylbenzenesulfonamide (PubChem CID 60824838) has the molecular formula C12H11BrN2O2S and a molecular weight of 327.20 g/mol. Its IUPAC name is 2-bromo-4-methyl-N-pyridin-2-ylbenzenesulfonamide.
| Compound Name | 2-bromo-4-methyl-N-pyridin-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 60824838 |
| Molecular Formula | C12H11BrN2O2S |
| Molecular Weight | 327.20 g/mol |
| Exact Mass | 325.97 |
| IUPAC Name | 2-bromo-4-methyl-N-pyridin-2-ylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccccn2)c(Br)c1 |
| InChI | InChI=1S/C12H11BrN2O2S/c1-9-5-6-11(10(13)8-9)18(16,17)15-12-4-2-3-7-14-12/h2-8H,1H3,(H,14,15) |
| InChIKey | TYRUQXIBKFRGIL-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.20 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |