C15H14ClNO4 — CID 60825317
2-(4-chloro-N-(5-ethylfuran-2-carbonyl)anilino)acetic acid (PubChem CID 60825317) has the molecular formula C15H14ClNO4 and a molecular weight of 307.73 g/mol. Its IUPAC name is 2-(4-chloro-N-(5-ethylfuran-2-carbonyl)anilino)acetic acid.
| Compound Name | 2-(4-chloro-N-(5-ethylfuran-2-carbonyl)anilino)acetic acid |
|---|---|
| PubChem CID | 60825317 |
| Molecular Formula | C15H14ClNO4 |
| Molecular Weight | 307.73 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | 2-(4-chloro-N-(5-ethylfuran-2-carbonyl)anilino)acetic acid |
| SMILES | CCc1ccc(C(=O)N(CC(=O)O)c2ccc(Cl)cc2)o1 |
| InChI | InChI=1S/C15H14ClNO4/c1-2-12-7-8-13(21-12)15(20)17(9-14(18)19)11-5-3-10(16)4-6-11/h3-8H,2,9H2,1H3,(H,18,19) |
| InChIKey | CHDGOFBLQOWNBH-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.73 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |