C15H20ClNO4 — CID 60826050
3-[tert-butyl-[2-(2-chlorophenoxy)acetyl]amino]propanoic acid (PubChem CID 60826050) has the molecular formula C15H20ClNO4 and a molecular weight of 313.78 g/mol. Its IUPAC name is 3-[tert-butyl-[2-(2-chlorophenoxy)acetyl]amino]propanoic acid.
| Compound Name | 3-[tert-butyl-[2-(2-chlorophenoxy)acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 60826050 |
| Molecular Formula | C15H20ClNO4 |
| Molecular Weight | 313.78 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 3-[tert-butyl-[2-(2-chlorophenoxy)acetyl]amino]propanoic acid |
| SMILES | CC(C)(C)N(CCC(=O)O)C(=O)COc1ccccc1Cl |
| InChI | InChI=1S/C15H20ClNO4/c1-15(2,3)17(9-8-14(19)20)13(18)10-21-12-7-5-4-6-11(12)16/h4-7H,8-10H2,1-3H3,(H,19,20) |
| InChIKey | WEJBXFKGFUFKIJ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.78 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |