C13H21N3O5 — CID 60826752
4-[[2-(3-methyl-2,5-dioxoimidazolidin-1-yl)acetyl]-propan-2-ylamino]butanoic acid (PubChem CID 60826752) has the molecular formula C13H21N3O5 and a molecular weight of 299.33 g/mol. Its IUPAC name is 4-[[2-(3-methyl-2,5-dioxoimidazolidin-1-yl)acetyl]-propan-2-ylamino]butanoic acid.
| Compound Name | 4-[[2-(3-methyl-2,5-dioxoimidazolidin-1-yl)acetyl]-propan-2-ylamino]butanoic acid |
|---|---|
| PubChem CID | 60826752 |
| Molecular Formula | C13H21N3O5 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | 4-[[2-(3-methyl-2,5-dioxoimidazolidin-1-yl)acetyl]-propan-2-ylamino]butanoic acid |
| SMILES | CC(C)N(CCCC(=O)O)C(=O)CN1C(=O)CN(C)C1=O |
| InChI | InChI=1S/C13H21N3O5/c1-9(2)15(6-4-5-12(19)20)11(18)8-16-10(17)7-14(3)13(16)21/h9H,4-8H2,1-3H3,(H,19,20) |
| InChIKey | CYXGCJCOKBXNOV-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 98.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|