C16H23NO4 — CID 60828723
2-[butan-2-yl-[3-(2-methylphenoxy)propanoyl]amino]acetic acid (PubChem CID 60828723) has the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. Its IUPAC name is 2-[butan-2-yl-[3-(2-methylphenoxy)propanoyl]amino]acetic acid.
| Compound Name | 2-[butan-2-yl-[3-(2-methylphenoxy)propanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 60828723 |
| Molecular Formula | C16H23NO4 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | 2-[butan-2-yl-[3-(2-methylphenoxy)propanoyl]amino]acetic acid |
| SMILES | CCC(C)N(CC(=O)O)C(=O)CCOc1ccccc1C |
| InChI | InChI=1S/C16H23NO4/c1-4-13(3)17(11-16(19)20)15(18)9-10-21-14-8-6-5-7-12(14)2/h5-8,13H,4,9-11H2,1-3H3,(H,19,20) |
| InChIKey | NLYUBOIRJQYCRI-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |