C11H22N2O3 — CID 60829080
2-[butan-2-yl(tert-butylcarbamoyl)amino]acetic acid (PubChem CID 60829080) has the molecular formula C11H22N2O3 and a molecular weight of 230.31 g/mol. Its IUPAC name is 2-[butan-2-yl(tert-butylcarbamoyl)amino]acetic acid.
| Compound Name | 2-[butan-2-yl(tert-butylcarbamoyl)amino]acetic acid |
|---|---|
| PubChem CID | 60829080 |
| Molecular Formula | C11H22N2O3 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.16 |
| IUPAC Name | 2-[butan-2-yl(tert-butylcarbamoyl)amino]acetic acid |
| SMILES | CCC(C)N(CC(=O)O)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C11H22N2O3/c1-6-8(2)13(7-9(14)15)10(16)12-11(3,4)5/h8H,6-7H2,1-5H3,(H,12,16)(H,14,15) |
| InChIKey | PLULWRVTPQWUBR-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |