C15H17NO2 — CID 608293
2,2,6-trimethyl-3,4-dihydropyrano[3,2-c]quinolin-5-one (PubChem CID 608293) has the molecular formula C15H17NO2 and a molecular weight of 243.31 g/mol. Its IUPAC name is 2,2,6-trimethyl-3,4-dihydropyrano[3,2-c]quinolin-5-one.
| Compound Name | 2,2,6-trimethyl-3,4-dihydropyrano[3,2-c]quinolin-5-one |
|---|---|
| PubChem CID | 608293 |
| Molecular Formula | C15H17NO2 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | 2,2,6-trimethyl-3,4-dihydropyrano[3,2-c]quinolin-5-one |
| SMILES | Cn1c(=O)c2c(c3ccccc31)OC(C)(C)CC2 |
| InChI | InChI=1S/C15H17NO2/c1-15(2)9-8-11-13(18-15)10-6-4-5-7-12(10)16(3)14(11)17/h4-7H,8-9H2,1-3H3 |
| InChIKey | QKYGYGWDLFBXPC-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |