About 2-propyl-5H-[1,3]oxazolo[4,5-c]quinolin-4-one
2-propyl-5H-[1,3]oxazolo[4,5-c]quinolin-4-one (PubChem CID 608301) has the molecular formula C13H12N2O2
and a molecular weight of 228.25 g/mol. Its IUPAC name is 2-propyl-5H-[1,3]oxazolo[4,5-c]quinolin-4-one.
Molecular Properties
| Compound Name | 2-propyl-5H-[1,3]oxazolo[4,5-c]quinolin-4-one |
| PubChem CID | 608301 |
| Molecular Formula | C13H12N2O2 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | 2-propyl-5H-[1,3]oxazolo[4,5-c]quinolin-4-one |
| SMILES | CCCc1nc2c(=O)[nH]c3ccccc3c2o1 |
| InChI | InChI=1S/C13H12N2O2/c1-2-5-10-15-11-12(17-10)8-6-3-4-7-9(8)14-13(11)16/h3-4,6-7H,2,5H2,1H3,(H,14,16) |
| InChIKey | WHTFZCDVWWLIFK-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-propyl-5H-[1,3]oxazolo[4,5-c]quinolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propyl-5H-[1,3]oxazolo[4,5-c]quinolin-4-one?
The IUPAC name of 2-propyl-5H-[1,3]oxazolo[4,5-c]quinolin-4-one (CID 608301) is 2-propyl-5H-[1,3]oxazolo[4,5-c]quinolin-4-one.
What is the SMILES notation for 2-propyl-5H-[1,3]oxazolo[4,5-c]quinolin-4-one?
The canonical SMILES for 2-propyl-5H-[1,3]oxazolo[4,5-c]quinolin-4-one is CCCc1nc2c(=O)[nH]c3ccccc3c2o1.
What is the InChIKey of 2-propyl-5H-[1,3]oxazolo[4,5-c]quinolin-4-one?
The InChIKey is WHTFZCDVWWLIFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2O2/c1-2-5-10-15-11-12(17-10)8-6-3-4-7-9(8)14-13(11)16/h3-4,6-7H,2,5H2,1H3,(H,14,16).
What are the key properties of 2-propyl-5H-[1,3]oxazolo[4,5-c]quinolin-4-one?
2-propyl-5H-[1,3]oxazolo[4,5-c]quinolin-4-one has a molecular weight of 228.25 g/mol, XLogP of 2.62, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propyl-5H-[1,3]oxazolo[4,5-c]quinolin-4-one is sourced from PubChem (CID 608301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).