C14H18ClNO3S — CID 60831942
3-[[2-(2-chlorophenyl)sulfanylacetyl]-propan-2-ylamino]propanoic acid (PubChem CID 60831942) has the molecular formula C14H18ClNO3S and a molecular weight of 315.82 g/mol. Its IUPAC name is 3-[[2-(2-chlorophenyl)sulfanylacetyl]-propan-2-ylamino]propanoic acid.
| Compound Name | 3-[[2-(2-chlorophenyl)sulfanylacetyl]-propan-2-ylamino]propanoic acid |
|---|---|
| PubChem CID | 60831942 |
| Molecular Formula | C14H18ClNO3S |
| Molecular Weight | 315.82 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | 3-[[2-(2-chlorophenyl)sulfanylacetyl]-propan-2-ylamino]propanoic acid |
| SMILES | CC(C)N(CCC(=O)O)C(=O)CSc1ccccc1Cl |
| InChI | InChI=1S/C14H18ClNO3S/c1-10(2)16(8-7-14(18)19)13(17)9-20-12-6-4-3-5-11(12)15/h3-6,10H,7-9H2,1-2H3,(H,18,19) |
| InChIKey | JKNFNWQORIMYFU-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.82 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |