C11H13N3O6 — CID 60832493
2-[[2-(2-oxopyrimidin-1-yl)acetyl]amino]pentanedioic acid (PubChem CID 60832493) has the molecular formula C11H13N3O6 and a molecular weight of 283.24 g/mol. Its IUPAC name is 2-[[2-(2-oxopyrimidin-1-yl)acetyl]amino]pentanedioic acid.
| Compound Name | 2-[[2-(2-oxopyrimidin-1-yl)acetyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 60832493 |
| Molecular Formula | C11H13N3O6 |
| Molecular Weight | 283.24 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | 2-[[2-(2-oxopyrimidin-1-yl)acetyl]amino]pentanedioic acid |
| SMILES | O=C(O)CCC(NC(=O)Cn1cccnc1=O)C(=O)O |
| InChI | InChI=1S/C11H13N3O6/c15-8(6-14-5-1-4-12-11(14)20)13-7(10(18)19)2-3-9(16)17/h1,4-5,7H,2-3,6H2,(H,13,15)(H,16,17)(H,18,19) |
| InChIKey | AZCOLRHLAOTYCR-UHFFFAOYSA-N |
| XLogP | -1.32 |
| TPSA | 138.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.24 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |