C15H20N2O3S — CID 60834359
2-[cyclopropyl-[2-oxo-2-(2-phenylsulfanylethylamino)ethyl]amino]acetic acid (PubChem CID 60834359) has the molecular formula C15H20N2O3S and a molecular weight of 308.40 g/mol. Its IUPAC name is 2-[cyclopropyl-[2-oxo-2-(2-phenylsulfanylethylamino)ethyl]amino]acetic acid.
| Compound Name | 2-[cyclopropyl-[2-oxo-2-(2-phenylsulfanylethylamino)ethyl]amino]acetic acid |
|---|---|
| PubChem CID | 60834359 |
| Molecular Formula | C15H20N2O3S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | 2-[cyclopropyl-[2-oxo-2-(2-phenylsulfanylethylamino)ethyl]amino]acetic acid |
| SMILES | O=C(O)CN(CC(=O)NCCSc1ccccc1)C1CC1 |
| InChI | InChI=1S/C15H20N2O3S/c18-14(10-17(11-15(19)20)12-6-7-12)16-8-9-21-13-4-2-1-3-5-13/h1-5,12H,6-11H2,(H,16,18)(H,19,20) |
| InChIKey | OSFBRNMRODARMM-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|