C15H24N2O4 — CID 60834441
2-[(1-butan-2-yl-2,5-dioxopyrrolidin-3-yl)-cyclopentylamino]acetic acid (PubChem CID 60834441) has the molecular formula C15H24N2O4 and a molecular weight of 296.37 g/mol. Its IUPAC name is 2-[(1-butan-2-yl-2,5-dioxopyrrolidin-3-yl)-cyclopentylamino]acetic acid.
| Compound Name | 2-[(1-butan-2-yl-2,5-dioxopyrrolidin-3-yl)-cyclopentylamino]acetic acid |
|---|---|
| PubChem CID | 60834441 |
| Molecular Formula | C15H24N2O4 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | 2-[(1-butan-2-yl-2,5-dioxopyrrolidin-3-yl)-cyclopentylamino]acetic acid |
| SMILES | CCC(C)N1C(=O)CC(N(CC(=O)O)C2CCCC2)C1=O |
| InChI | InChI=1S/C15H24N2O4/c1-3-10(2)17-13(18)8-12(15(17)21)16(9-14(19)20)11-6-4-5-7-11/h10-12H,3-9H2,1-2H3,(H,19,20) |
| InChIKey | PWYRWALSOQVAET-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|