C27H25N5O3S — CID 6083737
5,5-dimethyl-9-phenyl-13-[[(E)-1-thiophen-2-ylethylideneamino]oxymethyl]-2-oxa-12,14,15,17-tetrazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),3(8),11,13,16-pentaen-7-one (PubChem CID 6083737) has the molecular formula C27H25N5O3S and a molecular weight of 499.60 g/mol. Its IUPAC name is 5,5-dimethyl-9-phenyl-13-[[(E)-1-thiophen-2-ylethylideneamino]oxymethyl]-2-oxa-12,14,15,17-tetrazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),3(8),11,13,16-pentaen-7-one.
| Compound Name | 5,5-dimethyl-9-phenyl-13-[[(E)-1-thiophen-2-ylethylideneamino]oxymethyl]-2-oxa-12,14,15,17-tetrazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),3(8),11,13,16-pentaen-7-one |
|---|---|
| PubChem CID | 6083737 |
| Molecular Formula | C27H25N5O3S |
| Molecular Weight | 499.60 g/mol |
| Exact Mass | 499.17 |
| IUPAC Name | 5,5-dimethyl-9-phenyl-13-[[(E)-1-thiophen-2-ylethylideneamino]oxymethyl]-2-oxa-12,14,15,17-tetrazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),3(8),11,13,16-pentaen-7-one |
| SMILES | C/C(=N\OCc1nc2c3c(ncn2n1)OC1=C(C(=O)CC(C)(C)C1)C3c1ccccc1)c1cccs1 |
| InChI | InChI=1S/C27H25N5O3S/c1-16(20-10-7-11-36-20)31-34-14-21-29-25-24-22(17-8-5-4-6-9-17)23-18(33)12-27(2,3)13-19(23)35-26(24)28-15-32(25)30-21/h4-11,15,22H,12-14H2,1-3H3/b31-16+ |
| InChIKey | WTZJSWCRZWHEON-WCMJOSRZSA-N |
| XLogP | 5.29 |
| TPSA | 90.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.60 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|