C13H17FN2OS — CID 60837944
3-amino-N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)butanamide (PubChem CID 60837944) has the molecular formula C13H17FN2OS and a molecular weight of 268.36 g/mol. Its IUPAC name is 3-amino-N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)butanamide.
| Compound Name | 3-amino-N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)butanamide |
|---|---|
| PubChem CID | 60837944 |
| Molecular Formula | C13H17FN2OS |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 3-amino-N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)butanamide |
| SMILES | CC(N)CC(=O)NC1CCSc2ccc(F)cc21 |
| InChI | InChI=1S/C13H17FN2OS/c1-8(15)6-13(17)16-11-4-5-18-12-3-2-9(14)7-10(11)12/h2-3,7-8,11H,4-6,15H2,1H3,(H,16,17) |
| InChIKey | XVOUBVFRALTBKS-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |