C15H19ClN2O3 — CID 60838351
3-[[2-[(4-chlorophenyl)methylamino]-2-oxoethyl]-cyclopropylamino]propanoic acid (PubChem CID 60838351) has the molecular formula C15H19ClN2O3 and a molecular weight of 310.78 g/mol. Its IUPAC name is 3-[[2-[(4-chlorophenyl)methylamino]-2-oxoethyl]-cyclopropylamino]propanoic acid.
| Compound Name | 3-[[2-[(4-chlorophenyl)methylamino]-2-oxoethyl]-cyclopropylamino]propanoic acid |
|---|---|
| PubChem CID | 60838351 |
| Molecular Formula | C15H19ClN2O3 |
| Molecular Weight | 310.78 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 3-[[2-[(4-chlorophenyl)methylamino]-2-oxoethyl]-cyclopropylamino]propanoic acid |
| SMILES | O=C(O)CCN(CC(=O)NCc1ccc(Cl)cc1)C1CC1 |
| InChI | InChI=1S/C15H19ClN2O3/c16-12-3-1-11(2-4-12)9-17-14(19)10-18(13-5-6-13)8-7-15(20)21/h1-4,13H,5-10H2,(H,17,19)(H,20,21) |
| InChIKey | UUDZIQUZOBCCFM-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.78 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |