C14H14N2O4 — CID 60839788
1-(2,5-dioxopyrrolidin-3-yl)-3,4-dihydro-2H-quinoline-5-carboxylic acid (PubChem CID 60839788) has the molecular formula C14H14N2O4 and a molecular weight of 274.28 g/mol. Its IUPAC name is 1-(2,5-dioxopyrrolidin-3-yl)-3,4-dihydro-2H-quinoline-5-carboxylic acid.
| Compound Name | 1-(2,5-dioxopyrrolidin-3-yl)-3,4-dihydro-2H-quinoline-5-carboxylic acid |
|---|---|
| PubChem CID | 60839788 |
| Molecular Formula | C14H14N2O4 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 1-(2,5-dioxopyrrolidin-3-yl)-3,4-dihydro-2H-quinoline-5-carboxylic acid |
| SMILES | O=C1CC(N2CCCc3c(C(=O)O)cccc32)C(=O)N1 |
| InChI | InChI=1S/C14H14N2O4/c17-12-7-11(13(18)15-12)16-6-2-4-8-9(14(19)20)3-1-5-10(8)16/h1,3,5,11H,2,4,6-7H2,(H,19,20)(H,15,17,18) |
| InChIKey | JFKPZLNWFAORCR-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|