2-[(1,1-dioxothiolan-3-yl)-(oxan-2-ylmethyl)amino]acetic acid

C12H21NO5S — CID 60839895

IUPAC2-[(1,1-dioxothiolan-3-yl)-(oxan-2-ylmethyl)amino]acetic acid
SMILESO=C(O)CN(CC1CCCCO1)C1CCS(=O)(=O)C1
InChIInChI=1S/C12H21NO5S/c14-12(15)8-13(7-11-3-1-2-5-18-11)10-4-6-19(16,17)9-10/h10-11H,1-9H2,(H,14,15)
InChIKeyLSSKFHXETPJASC-UHFFFAOYSA-N
MW291.37 g/mol
LogP0.13
Rot. Bonds5

About 2-[(1,1-dioxothiolan-3-yl)-(oxan-2-ylmethyl)amino]acetic acid

2-[(1,1-dioxothiolan-3-yl)-(oxan-2-ylmethyl)amino]acetic acid (PubChem CID 60839895) has the molecular formula C12H21NO5S and a molecular weight of 291.37 g/mol. Its IUPAC name is 2-[(1,1-dioxothiolan-3-yl)-(oxan-2-ylmethyl)amino]acetic acid.

Molecular Properties

Compound Name2-[(1,1-dioxothiolan-3-yl)-(oxan-2-ylmethyl)amino]acetic acid
PubChem CID60839895
Molecular FormulaC12H21NO5S
Molecular Weight291.37 g/mol
Exact Mass291.11
IUPAC Name2-[(1,1-dioxothiolan-3-yl)-(oxan-2-ylmethyl)amino]acetic acid
SMILESO=C(O)CN(CC1CCCCO1)C1CCS(=O)(=O)C1
InChIInChI=1S/C12H21NO5S/c14-12(15)8-13(7-11-3-1-2-5-18-11)10-4-6-19(16,17)9-10/h10-11H,1-9H2,(H,14,15)
InChIKeyLSSKFHXETPJASC-UHFFFAOYSA-N
XLogP0.13
TPSA83.91 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500291.37
LogP ≤ 50.13
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 2-[(1,1-dioxothiolan-3-yl)-(oxan-2-ylmethyl)amino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(1,1-dioxothiolan-3-yl)-(oxan-2-ylmethyl)amino]acetic acid?
The IUPAC name of 2-[(1,1-dioxothiolan-3-yl)-(oxan-2-ylmethyl)amino]acetic acid (CID 60839895) is 2-[(1,1-dioxothiolan-3-yl)-(oxan-2-ylmethyl)amino]acetic acid.
What is the SMILES notation for 2-[(1,1-dioxothiolan-3-yl)-(oxan-2-ylmethyl)amino]acetic acid?
The canonical SMILES for 2-[(1,1-dioxothiolan-3-yl)-(oxan-2-ylmethyl)amino]acetic acid is O=C(O)CN(CC1CCCCO1)C1CCS(=O)(=O)C1.
What is the InChIKey of 2-[(1,1-dioxothiolan-3-yl)-(oxan-2-ylmethyl)amino]acetic acid?
The InChIKey is LSSKFHXETPJASC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21NO5S/c14-12(15)8-13(7-11-3-1-2-5-18-11)10-4-6-19(16,17)9-10/h10-11H,1-9H2,(H,14,15).
What are the key properties of 2-[(1,1-dioxothiolan-3-yl)-(oxan-2-ylmethyl)amino]acetic acid?
2-[(1,1-dioxothiolan-3-yl)-(oxan-2-ylmethyl)amino]acetic acid has a molecular weight of 291.37 g/mol, XLogP of 0.13, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1,1-dioxothiolan-3-yl)-(oxan-2-ylmethyl)amino]acetic acid is sourced from PubChem (CID 60839895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).