C12H21NO5S — CID 60839895
2-[(1,1-dioxothiolan-3-yl)-(oxan-2-ylmethyl)amino]acetic acid (PubChem CID 60839895) has the molecular formula C12H21NO5S and a molecular weight of 291.37 g/mol. Its IUPAC name is 2-[(1,1-dioxothiolan-3-yl)-(oxan-2-ylmethyl)amino]acetic acid.
| Compound Name | 2-[(1,1-dioxothiolan-3-yl)-(oxan-2-ylmethyl)amino]acetic acid |
|---|---|
| PubChem CID | 60839895 |
| Molecular Formula | C12H21NO5S |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 2-[(1,1-dioxothiolan-3-yl)-(oxan-2-ylmethyl)amino]acetic acid |
| SMILES | O=C(O)CN(CC1CCCCO1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H21NO5S/c14-12(15)8-13(7-11-3-1-2-5-18-11)10-4-6-19(16,17)9-10/h10-11H,1-9H2,(H,14,15) |
| InChIKey | LSSKFHXETPJASC-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |