3-[2-methyl-N-(1,2-oxazol-5-ylmethyl)anilino]propanoic acid

C14H16N2O3 — CID 60839934

IUPAC3-[2-methyl-N-(1,2-oxazol-5-ylmethyl)anilino]propanoic acid
SMILESCc1ccccc1N(CCC(=O)O)Cc1ccno1
InChIInChI=1S/C14H16N2O3/c1-11-4-2-3-5-13(11)16(9-7-14(17)18)10-12-6-8-15-19-12/h2-6,8H,7,9-10H2,1H3,(H,17,18)
InChIKeyOQJUZUNMWNHGDD-UHFFFAOYSA-N
MW260.29 g/mol
LogP2.46
Rot. Bonds6

About 3-[2-methyl-N-(1,2-oxazol-5-ylmethyl)anilino]propanoic acid

3-[2-methyl-N-(1,2-oxazol-5-ylmethyl)anilino]propanoic acid (PubChem CID 60839934) has the molecular formula C14H16N2O3 and a molecular weight of 260.29 g/mol. Its IUPAC name is 3-[2-methyl-N-(1,2-oxazol-5-ylmethyl)anilino]propanoic acid.

Molecular Properties

Compound Name3-[2-methyl-N-(1,2-oxazol-5-ylmethyl)anilino]propanoic acid
PubChem CID60839934
Molecular FormulaC14H16N2O3
Molecular Weight260.29 g/mol
Exact Mass260.12
IUPAC Name3-[2-methyl-N-(1,2-oxazol-5-ylmethyl)anilino]propanoic acid
SMILESCc1ccccc1N(CCC(=O)O)Cc1ccno1
InChIInChI=1S/C14H16N2O3/c1-11-4-2-3-5-13(11)16(9-7-14(17)18)10-12-6-8-15-19-12/h2-6,8H,7,9-10H2,1H3,(H,17,18)
InChIKeyOQJUZUNMWNHGDD-UHFFFAOYSA-N
XLogP2.46
TPSA66.57 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500260.29
LogP ≤ 52.46
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 3-[2-methyl-N-(1,2-oxazol-5-ylmethyl)anilino]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[2-methyl-N-(1,2-oxazol-5-ylmethyl)anilino]propanoic acid?
The IUPAC name of 3-[2-methyl-N-(1,2-oxazol-5-ylmethyl)anilino]propanoic acid (CID 60839934) is 3-[2-methyl-N-(1,2-oxazol-5-ylmethyl)anilino]propanoic acid.
What is the SMILES notation for 3-[2-methyl-N-(1,2-oxazol-5-ylmethyl)anilino]propanoic acid?
The canonical SMILES for 3-[2-methyl-N-(1,2-oxazol-5-ylmethyl)anilino]propanoic acid is Cc1ccccc1N(CCC(=O)O)Cc1ccno1.
What is the InChIKey of 3-[2-methyl-N-(1,2-oxazol-5-ylmethyl)anilino]propanoic acid?
The InChIKey is OQJUZUNMWNHGDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2O3/c1-11-4-2-3-5-13(11)16(9-7-14(17)18)10-12-6-8-15-19-12/h2-6,8H,7,9-10H2,1H3,(H,17,18).
What are the key properties of 3-[2-methyl-N-(1,2-oxazol-5-ylmethyl)anilino]propanoic acid?
3-[2-methyl-N-(1,2-oxazol-5-ylmethyl)anilino]propanoic acid has a molecular weight of 260.29 g/mol, XLogP of 2.46, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-methyl-N-(1,2-oxazol-5-ylmethyl)anilino]propanoic acid is sourced from PubChem (CID 60839934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).