C14H17NO2 — CID 60840478
1-[(E)-but-2-enyl]-3,4-dihydro-2H-quinoline-5-carboxylic acid (PubChem CID 60840478) has the molecular formula C14H17NO2 and a molecular weight of 231.30 g/mol. Its IUPAC name is 1-[(E)-but-2-enyl]-3,4-dihydro-2H-quinoline-5-carboxylic acid.
| Compound Name | 1-[(E)-but-2-enyl]-3,4-dihydro-2H-quinoline-5-carboxylic acid |
|---|---|
| PubChem CID | 60840478 |
| Molecular Formula | C14H17NO2 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | 1-[(E)-but-2-enyl]-3,4-dihydro-2H-quinoline-5-carboxylic acid |
| SMILES | C/C=C/CN1CCCc2c(C(=O)O)cccc21 |
| InChI | InChI=1S/C14H17NO2/c1-2-3-9-15-10-5-7-11-12(14(16)17)6-4-8-13(11)15/h2-4,6,8H,5,7,9-10H2,1H3,(H,16,17)/b3-2+ |
| InChIKey | UFPYXYSBVNLDCV-NSCUHMNNSA-N |
| XLogP | 2.71 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|