C14H19N3O4 — CID 60840590
2-(4-methyl-N-[1-(methylcarbamoylamino)-1-oxopropan-2-yl]anilino)acetic acid (PubChem CID 60840590) has the molecular formula C14H19N3O4 and a molecular weight of 293.32 g/mol. Its IUPAC name is 2-(4-methyl-N-[1-(methylcarbamoylamino)-1-oxopropan-2-yl]anilino)acetic acid.
| Compound Name | 2-(4-methyl-N-[1-(methylcarbamoylamino)-1-oxopropan-2-yl]anilino)acetic acid |
|---|---|
| PubChem CID | 60840590 |
| Molecular Formula | C14H19N3O4 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 2-(4-methyl-N-[1-(methylcarbamoylamino)-1-oxopropan-2-yl]anilino)acetic acid |
| SMILES | CNC(=O)NC(=O)C(C)N(CC(=O)O)c1ccc(C)cc1 |
| InChI | InChI=1S/C14H19N3O4/c1-9-4-6-11(7-5-9)17(8-12(18)19)10(2)13(20)16-14(21)15-3/h4-7,10H,8H2,1-3H3,(H,18,19)(H2,15,16,20,21) |
| InChIKey | NEAJJCXSHQVWSI-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|