2-[(1,1-dioxothiolan-3-yl)-hexylamino]acetic acid

C12H23NO4S — CID 60840739

IUPAC2-[(1,1-dioxothiolan-3-yl)-hexylamino]acetic acid
SMILESCCCCCCN(CC(=O)O)C1CCS(=O)(=O)C1
InChIInChI=1S/C12H23NO4S/c1-2-3-4-5-7-13(9-12(14)15)11-6-8-18(16,17)10-11/h11H,2-10H2,1H3,(H,14,15)
InChIKeyNSWGAJOQQFKDFL-UHFFFAOYSA-N
MW277.39 g/mol
LogP1.14
Rot. Bonds8

About 2-[(1,1-dioxothiolan-3-yl)-hexylamino]acetic acid

2-[(1,1-dioxothiolan-3-yl)-hexylamino]acetic acid (PubChem CID 60840739) has the molecular formula C12H23NO4S and a molecular weight of 277.39 g/mol. Its IUPAC name is 2-[(1,1-dioxothiolan-3-yl)-hexylamino]acetic acid.

Molecular Properties

Compound Name2-[(1,1-dioxothiolan-3-yl)-hexylamino]acetic acid
PubChem CID60840739
Molecular FormulaC12H23NO4S
Molecular Weight277.39 g/mol
Exact Mass277.13
IUPAC Name2-[(1,1-dioxothiolan-3-yl)-hexylamino]acetic acid
SMILESCCCCCCN(CC(=O)O)C1CCS(=O)(=O)C1
InChIInChI=1S/C12H23NO4S/c1-2-3-4-5-7-13(9-12(14)15)11-6-8-18(16,17)10-11/h11H,2-10H2,1H3,(H,14,15)
InChIKeyNSWGAJOQQFKDFL-UHFFFAOYSA-N
XLogP1.14
TPSA74.68 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds8
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500277.39
LogP ≤ 51.14
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2-[(1,1-dioxothiolan-3-yl)-hexylamino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(1,1-dioxothiolan-3-yl)-hexylamino]acetic acid?
The IUPAC name of 2-[(1,1-dioxothiolan-3-yl)-hexylamino]acetic acid (CID 60840739) is 2-[(1,1-dioxothiolan-3-yl)-hexylamino]acetic acid.
What is the SMILES notation for 2-[(1,1-dioxothiolan-3-yl)-hexylamino]acetic acid?
The canonical SMILES for 2-[(1,1-dioxothiolan-3-yl)-hexylamino]acetic acid is CCCCCCN(CC(=O)O)C1CCS(=O)(=O)C1.
What is the InChIKey of 2-[(1,1-dioxothiolan-3-yl)-hexylamino]acetic acid?
The InChIKey is NSWGAJOQQFKDFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NO4S/c1-2-3-4-5-7-13(9-12(14)15)11-6-8-18(16,17)10-11/h11H,2-10H2,1H3,(H,14,15).
What are the key properties of 2-[(1,1-dioxothiolan-3-yl)-hexylamino]acetic acid?
2-[(1,1-dioxothiolan-3-yl)-hexylamino]acetic acid has a molecular weight of 277.39 g/mol, XLogP of 1.14, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1,1-dioxothiolan-3-yl)-hexylamino]acetic acid is sourced from PubChem (CID 60840739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).