About N-[2-(3-methyl-1,2,4-oxadiazol-5-yl)phenyl]-2-(propan-2-ylamino)acetamide
N-[2-(3-methyl-1,2,4-oxadiazol-5-yl)phenyl]-2-(propan-2-ylamino)acetamide (PubChem CID 60841655) has the molecular formula C14H18N4O2
and a molecular weight of 274.32 g/mol. Its IUPAC name is N-[2-(3-methyl-1,2,4-oxadiazol-5-yl)phenyl]-2-(propan-2-ylamino)acetamide.
Molecular Properties
| Compound Name | N-[2-(3-methyl-1,2,4-oxadiazol-5-yl)phenyl]-2-(propan-2-ylamino)acetamide |
| PubChem CID | 60841655 |
| Molecular Formula | C14H18N4O2 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | N-[2-(3-methyl-1,2,4-oxadiazol-5-yl)phenyl]-2-(propan-2-ylamino)acetamide |
| SMILES | Cc1noc(-c2ccccc2NC(=O)CNC(C)C)n1 |
| InChI | InChI=1S/C14H18N4O2/c1-9(2)15-8-13(19)17-12-7-5-4-6-11(12)14-16-10(3)18-20-14/h4-7,9,15H,8H2,1-3H3,(H,17,19) |
| InChIKey | KFCJMWRSOXCYHO-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[2-(3-methyl-1,2,4-oxadiazol-5-yl)phenyl]-2-(propan-2-ylamino)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(3-methyl-1,2,4-oxadiazol-5-yl)phenyl]-2-(propan-2-ylamino)acetamide?
The IUPAC name of N-[2-(3-methyl-1,2,4-oxadiazol-5-yl)phenyl]-2-(propan-2-ylamino)acetamide (CID 60841655) is N-[2-(3-methyl-1,2,4-oxadiazol-5-yl)phenyl]-2-(propan-2-ylamino)acetamide.
What is the SMILES notation for N-[2-(3-methyl-1,2,4-oxadiazol-5-yl)phenyl]-2-(propan-2-ylamino)acetamide?
The canonical SMILES for N-[2-(3-methyl-1,2,4-oxadiazol-5-yl)phenyl]-2-(propan-2-ylamino)acetamide is Cc1noc(-c2ccccc2NC(=O)CNC(C)C)n1.
What is the InChIKey of N-[2-(3-methyl-1,2,4-oxadiazol-5-yl)phenyl]-2-(propan-2-ylamino)acetamide?
The InChIKey is KFCJMWRSOXCYHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N4O2/c1-9(2)15-8-13(19)17-12-7-5-4-6-11(12)14-16-10(3)18-20-14/h4-7,9,15H,8H2,1-3H3,(H,17,19).
What are the key properties of N-[2-(3-methyl-1,2,4-oxadiazol-5-yl)phenyl]-2-(propan-2-ylamino)acetamide?
N-[2-(3-methyl-1,2,4-oxadiazol-5-yl)phenyl]-2-(propan-2-ylamino)acetamide has a molecular weight of 274.32 g/mol, XLogP of 1.98, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(3-methyl-1,2,4-oxadiazol-5-yl)phenyl]-2-(propan-2-ylamino)acetamide is sourced from PubChem (CID 60841655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).