C14H25N5O — CID 60842948
4-(methylamino)-N-[1-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]butanamide (PubChem CID 60842948) has the molecular formula C14H25N5O and a molecular weight of 279.39 g/mol. Its IUPAC name is 4-(methylamino)-N-[1-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]butanamide.
| Compound Name | 4-(methylamino)-N-[1-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]butanamide |
|---|---|
| PubChem CID | 60842948 |
| Molecular Formula | C14H25N5O |
| Molecular Weight | 279.39 g/mol |
| Exact Mass | 279.21 |
| IUPAC Name | 4-(methylamino)-N-[1-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]butanamide |
| SMILES | CNCCCC(=O)NC(C)c1nnc2n1CCCCC2 |
| InChI | InChI=1S/C14H25N5O/c1-11(16-13(20)8-6-9-15-2)14-18-17-12-7-4-3-5-10-19(12)14/h11,15H,3-10H2,1-2H3,(H,16,20) |
| InChIKey | RMWROEKLEVQCKU-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.39 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|