C14H18N2O3S — CID 60844274
3-[3-(2-methylmorpholin-4-yl)sulfonylphenyl]prop-2-yn-1-amine (PubChem CID 60844274) has the molecular formula C14H18N2O3S and a molecular weight of 294.38 g/mol. Its IUPAC name is 3-[3-(2-methylmorpholin-4-yl)sulfonylphenyl]prop-2-yn-1-amine.
| Compound Name | 3-[3-(2-methylmorpholin-4-yl)sulfonylphenyl]prop-2-yn-1-amine |
|---|---|
| PubChem CID | 60844274 |
| Molecular Formula | C14H18N2O3S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 3-[3-(2-methylmorpholin-4-yl)sulfonylphenyl]prop-2-yn-1-amine |
| SMILES | CC1CN(S(=O)(=O)c2cccc(C#CCN)c2)CCO1 |
| InChI | InChI=1S/C14H18N2O3S/c1-12-11-16(8-9-19-12)20(17,18)14-6-2-4-13(10-14)5-3-7-15/h2,4,6,10,12H,7-9,11,15H2,1H3 |
| InChIKey | RJEVYPITRYTMPX-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|