C16H21NO3 — CID 60844382
3-(4-methyl-N-[(E)-2-methylpent-2-enoyl]anilino)propanoic acid (PubChem CID 60844382) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is 3-(4-methyl-N-[(E)-2-methylpent-2-enoyl]anilino)propanoic acid.
| Compound Name | 3-(4-methyl-N-[(E)-2-methylpent-2-enoyl]anilino)propanoic acid |
|---|---|
| PubChem CID | 60844382 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | 3-(4-methyl-N-[(E)-2-methylpent-2-enoyl]anilino)propanoic acid |
| SMILES | CC/C=C(\C)C(=O)N(CCC(=O)O)c1ccc(C)cc1 |
| InChI | InChI=1S/C16H21NO3/c1-4-5-13(3)16(20)17(11-10-15(18)19)14-8-6-12(2)7-9-14/h5-9H,4,10-11H2,1-3H3,(H,18,19)/b13-5+ |
| InChIKey | YXGDMJWWUBIVEJ-WLRTZDKTSA-N |
| XLogP | 3.16 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|