C10H15N3O3 — CID 60847606
2-amino-N-[2-[2-(furan-2-yl)ethylamino]-2-oxoethyl]acetamide (PubChem CID 60847606) has the molecular formula C10H15N3O3 and a molecular weight of 225.25 g/mol. Its IUPAC name is 2-amino-N-[2-[2-(furan-2-yl)ethylamino]-2-oxoethyl]acetamide.
| Compound Name | 2-amino-N-[2-[2-(furan-2-yl)ethylamino]-2-oxoethyl]acetamide |
|---|---|
| PubChem CID | 60847606 |
| Molecular Formula | C10H15N3O3 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.11 |
| IUPAC Name | 2-amino-N-[2-[2-(furan-2-yl)ethylamino]-2-oxoethyl]acetamide |
| SMILES | NCC(=O)NCC(=O)NCCc1ccco1 |
| InChI | InChI=1S/C10H15N3O3/c11-6-9(14)13-7-10(15)12-4-3-8-2-1-5-16-8/h1-2,5H,3-4,6-7,11H2,(H,12,15)(H,13,14) |
| InChIKey | WXUNJRSYKTYZHX-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 97.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |