About [2-(2,5-dimethylpyrrol-1-yl)phenyl]methanol
[2-(2,5-dimethylpyrrol-1-yl)phenyl]methanol (PubChem CID 608481) has the molecular formula C13H15NO
and a molecular weight of 201.27 g/mol. Its IUPAC name is [2-(2,5-dimethylpyrrol-1-yl)phenyl]methanol.
Molecular Properties
| Compound Name | [2-(2,5-dimethylpyrrol-1-yl)phenyl]methanol |
| PubChem CID | 608481 |
| Molecular Formula | C13H15NO |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | [2-(2,5-dimethylpyrrol-1-yl)phenyl]methanol |
| SMILES | Cc1ccc(C)n1-c1ccccc1CO |
| InChI | InChI=1S/C13H15NO/c1-10-7-8-11(2)14(10)13-6-4-3-5-12(13)9-15/h3-8,15H,9H2,1-2H3 |
| InChIKey | FWGFXLVQDMQFBT-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|
Analyze [2-(2,5-dimethylpyrrol-1-yl)phenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2,5-dimethylpyrrol-1-yl)phenyl]methanol?
The IUPAC name of [2-(2,5-dimethylpyrrol-1-yl)phenyl]methanol (CID 608481) is [2-(2,5-dimethylpyrrol-1-yl)phenyl]methanol.
What is the SMILES notation for [2-(2,5-dimethylpyrrol-1-yl)phenyl]methanol?
The canonical SMILES for [2-(2,5-dimethylpyrrol-1-yl)phenyl]methanol is Cc1ccc(C)n1-c1ccccc1CO.
What is the InChIKey of [2-(2,5-dimethylpyrrol-1-yl)phenyl]methanol?
The InChIKey is FWGFXLVQDMQFBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO/c1-10-7-8-11(2)14(10)13-6-4-3-5-12(13)9-15/h3-8,15H,9H2,1-2H3.
What are the key properties of [2-(2,5-dimethylpyrrol-1-yl)phenyl]methanol?
[2-(2,5-dimethylpyrrol-1-yl)phenyl]methanol has a molecular weight of 201.27 g/mol, XLogP of 2.59, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2,5-dimethylpyrrol-1-yl)phenyl]methanol is sourced from PubChem (CID 608481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).