C11H16N4O2 — CID 60848302
2-amino-N-[2-oxo-2-(1-pyridin-4-ylethylamino)ethyl]acetamide (PubChem CID 60848302) has the molecular formula C11H16N4O2 and a molecular weight of 236.28 g/mol. Its IUPAC name is 2-amino-N-[2-oxo-2-(1-pyridin-4-ylethylamino)ethyl]acetamide.
| Compound Name | 2-amino-N-[2-oxo-2-(1-pyridin-4-ylethylamino)ethyl]acetamide |
|---|---|
| PubChem CID | 60848302 |
| Molecular Formula | C11H16N4O2 |
| Molecular Weight | 236.28 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 2-amino-N-[2-oxo-2-(1-pyridin-4-ylethylamino)ethyl]acetamide |
| SMILES | CC(NC(=O)CNC(=O)CN)c1ccncc1 |
| InChI | InChI=1S/C11H16N4O2/c1-8(9-2-4-13-5-3-9)15-11(17)7-14-10(16)6-12/h2-5,8H,6-7,12H2,1H3,(H,14,16)(H,15,17) |
| InChIKey | FXLPIQZYFMYWHG-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.28 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |