About 7-methoxy-2,3-dihydrofuro[2,3-b]quinoline
7-methoxy-2,3-dihydrofuro[2,3-b]quinoline (PubChem CID 608484) has the molecular formula C12H11NO2
and a molecular weight of 201.22 g/mol. Its IUPAC name is 7-methoxy-2,3-dihydrofuro[2,3-b]quinoline.
Molecular Properties
| Compound Name | 7-methoxy-2,3-dihydrofuro[2,3-b]quinoline |
| PubChem CID | 608484 |
| Molecular Formula | C12H11NO2 |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.08 |
| IUPAC Name | 7-methoxy-2,3-dihydrofuro[2,3-b]quinoline |
| SMILES | COc1ccc2cc3c(nc2c1)OCC3 |
| InChI | InChI=1S/C12H11NO2/c1-14-10-3-2-8-6-9-4-5-15-12(9)13-11(8)7-10/h2-3,6-7H,4-5H2,1H3 |
| InChIKey | CJRXDGACBICTPN-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-methoxy-2,3-dihydrofuro[2,3-b]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methoxy-2,3-dihydrofuro[2,3-b]quinoline?
The IUPAC name of 7-methoxy-2,3-dihydrofuro[2,3-b]quinoline (CID 608484) is 7-methoxy-2,3-dihydrofuro[2,3-b]quinoline.
What is the SMILES notation for 7-methoxy-2,3-dihydrofuro[2,3-b]quinoline?
The canonical SMILES for 7-methoxy-2,3-dihydrofuro[2,3-b]quinoline is COc1ccc2cc3c(nc2c1)OCC3.
What is the InChIKey of 7-methoxy-2,3-dihydrofuro[2,3-b]quinoline?
The InChIKey is CJRXDGACBICTPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NO2/c1-14-10-3-2-8-6-9-4-5-15-12(9)13-11(8)7-10/h2-3,6-7H,4-5H2,1H3.
What are the key properties of 7-methoxy-2,3-dihydrofuro[2,3-b]quinoline?
7-methoxy-2,3-dihydrofuro[2,3-b]quinoline has a molecular weight of 201.22 g/mol, XLogP of 2.18, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methoxy-2,3-dihydrofuro[2,3-b]quinoline is sourced from PubChem (CID 608484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).