C12H19N5O3 — CID 60849618
2-amino-N-[1-(oxolan-2-ylmethyl)pyrazol-4-yl]butanediamide (PubChem CID 60849618) has the molecular formula C12H19N5O3 and a molecular weight of 281.32 g/mol. Its IUPAC name is 2-amino-N-[1-(oxolan-2-ylmethyl)pyrazol-4-yl]butanediamide.
| Compound Name | 2-amino-N-[1-(oxolan-2-ylmethyl)pyrazol-4-yl]butanediamide |
|---|---|
| PubChem CID | 60849618 |
| Molecular Formula | C12H19N5O3 |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | 2-amino-N-[1-(oxolan-2-ylmethyl)pyrazol-4-yl]butanediamide |
| SMILES | NC(=O)CC(N)C(=O)Nc1cnn(CC2CCCO2)c1 |
| InChI | InChI=1S/C12H19N5O3/c13-10(4-11(14)18)12(19)16-8-5-15-17(6-8)7-9-2-1-3-20-9/h5-6,9-10H,1-4,7,13H2,(H2,14,18)(H,16,19) |
| InChIKey | BCZNIZAYHWYZCF-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 125.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |