C14H22N2O2 — CID 60850282
N-[2-(hydroxymethyl)phenyl]-4-(propan-2-ylamino)butanamide (PubChem CID 60850282) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is N-[2-(hydroxymethyl)phenyl]-4-(propan-2-ylamino)butanamide.
| Compound Name | N-[2-(hydroxymethyl)phenyl]-4-(propan-2-ylamino)butanamide |
|---|---|
| PubChem CID | 60850282 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | N-[2-(hydroxymethyl)phenyl]-4-(propan-2-ylamino)butanamide |
| SMILES | CC(C)NCCCC(=O)Nc1ccccc1CO |
| InChI | InChI=1S/C14H22N2O2/c1-11(2)15-9-5-8-14(18)16-13-7-4-3-6-12(13)10-17/h3-4,6-7,11,15,17H,5,8-10H2,1-2H3,(H,16,18) |
| InChIKey | BGTQTCUECXWQJR-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|