C14H21BrN2O — CID 60850398
N-(4-bromo-2-methylphenyl)-4-(propan-2-ylamino)butanamide (PubChem CID 60850398) has the molecular formula C14H21BrN2O and a molecular weight of 313.24 g/mol. Its IUPAC name is N-(4-bromo-2-methylphenyl)-4-(propan-2-ylamino)butanamide.
| Compound Name | N-(4-bromo-2-methylphenyl)-4-(propan-2-ylamino)butanamide |
|---|---|
| PubChem CID | 60850398 |
| Molecular Formula | C14H21BrN2O |
| Molecular Weight | 313.24 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | N-(4-bromo-2-methylphenyl)-4-(propan-2-ylamino)butanamide |
| SMILES | Cc1cc(Br)ccc1NC(=O)CCCNC(C)C |
| InChI | InChI=1S/C14H21BrN2O/c1-10(2)16-8-4-5-14(18)17-13-7-6-12(15)9-11(13)3/h6-7,9-10,16H,4-5,8H2,1-3H3,(H,17,18) |
| InChIKey | OIXJLLXVXTYRTG-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.24 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|