C15H19FN2O3 — CID 60850707
methyl 2-[[2-(cyclopentylamino)acetyl]amino]-5-fluorobenzoate (PubChem CID 60850707) has the molecular formula C15H19FN2O3 and a molecular weight of 294.33 g/mol. Its IUPAC name is methyl 2-[[2-(cyclopentylamino)acetyl]amino]-5-fluorobenzoate.
| Compound Name | methyl 2-[[2-(cyclopentylamino)acetyl]amino]-5-fluorobenzoate |
|---|---|
| PubChem CID | 60850707 |
| Molecular Formula | C15H19FN2O3 |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | methyl 2-[[2-(cyclopentylamino)acetyl]amino]-5-fluorobenzoate |
| SMILES | COC(=O)c1cc(F)ccc1NC(=O)CNC1CCCC1 |
| InChI | InChI=1S/C15H19FN2O3/c1-21-15(20)12-8-10(16)6-7-13(12)18-14(19)9-17-11-4-2-3-5-11/h6-8,11,17H,2-5,9H2,1H3,(H,18,19) |
| InChIKey | JHOYOSGNGWAYOU-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |