C15H24N2O — CID 60850941
N-[(4-methylphenyl)methyl]-4-(propan-2-ylamino)butanamide (PubChem CID 60850941) has the molecular formula C15H24N2O and a molecular weight of 248.37 g/mol. Its IUPAC name is N-[(4-methylphenyl)methyl]-4-(propan-2-ylamino)butanamide.
| Compound Name | N-[(4-methylphenyl)methyl]-4-(propan-2-ylamino)butanamide |
|---|---|
| PubChem CID | 60850941 |
| Molecular Formula | C15H24N2O |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | N-[(4-methylphenyl)methyl]-4-(propan-2-ylamino)butanamide |
| SMILES | Cc1ccc(CNC(=O)CCCNC(C)C)cc1 |
| InChI | InChI=1S/C15H24N2O/c1-12(2)16-10-4-5-15(18)17-11-14-8-6-13(3)7-9-14/h6-9,12,16H,4-5,10-11H2,1-3H3,(H,17,18) |
| InChIKey | KDRXOKLJGAFKGU-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|