C15H23N3O3 — CID 60852115
2-(butan-2-ylamino)-N-[3-[2-(methylamino)-2-oxoethoxy]phenyl]acetamide (PubChem CID 60852115) has the molecular formula C15H23N3O3 and a molecular weight of 293.37 g/mol. Its IUPAC name is 2-(butan-2-ylamino)-N-[3-[2-(methylamino)-2-oxoethoxy]phenyl]acetamide.
| Compound Name | 2-(butan-2-ylamino)-N-[3-[2-(methylamino)-2-oxoethoxy]phenyl]acetamide |
|---|---|
| PubChem CID | 60852115 |
| Molecular Formula | C15H23N3O3 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | 2-(butan-2-ylamino)-N-[3-[2-(methylamino)-2-oxoethoxy]phenyl]acetamide |
| SMILES | CCC(C)NCC(=O)Nc1cccc(OCC(=O)NC)c1 |
| InChI | InChI=1S/C15H23N3O3/c1-4-11(2)17-9-14(19)18-12-6-5-7-13(8-12)21-10-15(20)16-3/h5-8,11,17H,4,9-10H2,1-3H3,(H,16,20)(H,18,19) |
| InChIKey | FRKLWTCQKFVGIJ-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |