About 3-(propan-2-ylamino)-N,N-bis(prop-2-enyl)propanamide
3-(propan-2-ylamino)-N,N-bis(prop-2-enyl)propanamide (PubChem CID 60852148) has the molecular formula C12H22N2O
and a molecular weight of 210.32 g/mol. Its IUPAC name is 3-(propan-2-ylamino)-N,N-bis(prop-2-enyl)propanamide.
Molecular Properties
| Compound Name | 3-(propan-2-ylamino)-N,N-bis(prop-2-enyl)propanamide |
| PubChem CID | 60852148 |
| Molecular Formula | C12H22N2O |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.17 |
| IUPAC Name | 3-(propan-2-ylamino)-N,N-bis(prop-2-enyl)propanamide |
| SMILES | C=CCN(CC=C)C(=O)CCNC(C)C |
| InChI | InChI=1S/C12H22N2O/c1-5-9-14(10-6-2)12(15)7-8-13-11(3)4/h5-6,11,13H,1-2,7-10H2,3-4H3 |
| InChIKey | XHDVOGQGQGVDBS-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-(propan-2-ylamino)-N,N-bis(prop-2-enyl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(propan-2-ylamino)-N,N-bis(prop-2-enyl)propanamide?
The IUPAC name of 3-(propan-2-ylamino)-N,N-bis(prop-2-enyl)propanamide (CID 60852148) is 3-(propan-2-ylamino)-N,N-bis(prop-2-enyl)propanamide.
What is the SMILES notation for 3-(propan-2-ylamino)-N,N-bis(prop-2-enyl)propanamide?
The canonical SMILES for 3-(propan-2-ylamino)-N,N-bis(prop-2-enyl)propanamide is C=CCN(CC=C)C(=O)CCNC(C)C.
What is the InChIKey of 3-(propan-2-ylamino)-N,N-bis(prop-2-enyl)propanamide?
The InChIKey is XHDVOGQGQGVDBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2O/c1-5-9-14(10-6-2)12(15)7-8-13-11(3)4/h5-6,11,13H,1-2,7-10H2,3-4H3.
What are the key properties of 3-(propan-2-ylamino)-N,N-bis(prop-2-enyl)propanamide?
3-(propan-2-ylamino)-N,N-bis(prop-2-enyl)propanamide has a molecular weight of 210.32 g/mol, XLogP of 1.58, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(propan-2-ylamino)-N,N-bis(prop-2-enyl)propanamide is sourced from PubChem (CID 60852148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).