C18H36N2 — CID 60853322
1-N,1-N-dicyclohexyl-2-methylpentane-1,2-diamine (PubChem CID 60853322) has the molecular formula C18H36N2 and a molecular weight of 280.50 g/mol. Its IUPAC name is 1-N,1-N-dicyclohexyl-2-methylpentane-1,2-diamine.
| Compound Name | 1-N,1-N-dicyclohexyl-2-methylpentane-1,2-diamine |
|---|---|
| PubChem CID | 60853322 |
| Molecular Formula | C18H36N2 |
| Molecular Weight | 280.50 g/mol |
| Exact Mass | 280.29 |
| IUPAC Name | 1-N,1-N-dicyclohexyl-2-methylpentane-1,2-diamine |
| SMILES | CCCC(C)(N)CN(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C18H36N2/c1-3-14-18(2,19)15-20(16-10-6-4-7-11-16)17-12-8-5-9-13-17/h16-17H,3-15,19H2,1-2H3 |
| InChIKey | ITDOOMZHSZJDIF-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.50 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |