C16H15BrN4O2 — CID 6085415
N-[(E)-[4-(4-bromoanilino)-4-oxobutan-2-ylidene]amino]pyridine-4-carboxamide (PubChem CID 6085415) has the molecular formula C16H15BrN4O2 and a molecular weight of 375.23 g/mol. Its IUPAC name is N-[(E)-[4-(4-bromoanilino)-4-oxobutan-2-ylidene]amino]pyridine-4-carboxamide.
| Compound Name | N-[(E)-[4-(4-bromoanilino)-4-oxobutan-2-ylidene]amino]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 6085415 |
| Molecular Formula | C16H15BrN4O2 |
| Molecular Weight | 375.23 g/mol |
| Exact Mass | 374.04 |
| IUPAC Name | N-[(E)-[4-(4-bromoanilino)-4-oxobutan-2-ylidene]amino]pyridine-4-carboxamide |
| SMILES | C/C(CC(=O)Nc1ccc(Br)cc1)=N\NC(=O)c1ccncc1 |
| InChI | InChI=1S/C16H15BrN4O2/c1-11(20-21-16(23)12-6-8-18-9-7-12)10-15(22)19-14-4-2-13(17)3-5-14/h2-9H,10H2,1H3,(H,19,22)(H,21,23)/b20-11+ |
| InChIKey | WGIZFJWWAOWGCR-RGVLZGJSSA-N |
| XLogP | 2.98 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.23 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|