About 5-bromo-2,6-dimethylpyrimidin-4-amine
5-bromo-2,6-dimethylpyrimidin-4-amine (PubChem CID 608548) has the molecular formula C6H8BrN3
and a molecular weight of 202.06 g/mol. Its IUPAC name is 5-bromo-2,6-dimethylpyrimidin-4-amine.
Molecular Properties
| Compound Name | 5-bromo-2,6-dimethylpyrimidin-4-amine |
| PubChem CID | 608548 |
| Molecular Formula | C6H8BrN3 |
| Molecular Weight | 202.06 g/mol |
| Exact Mass | 200.99 |
| IUPAC Name | 5-bromo-2,6-dimethylpyrimidin-4-amine |
| SMILES | Cc1nc(C)c(Br)c(N)n1 |
| InChI | InChI=1S/C6H8BrN3/c1-3-5(7)6(8)10-4(2)9-3/h1-2H3,(H2,8,9,10) |
| InChIKey | BGFGBTQZFTZLFH-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.06 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-bromo-2,6-dimethylpyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2,6-dimethylpyrimidin-4-amine?
The IUPAC name of 5-bromo-2,6-dimethylpyrimidin-4-amine (CID 608548) is 5-bromo-2,6-dimethylpyrimidin-4-amine.
What is the SMILES notation for 5-bromo-2,6-dimethylpyrimidin-4-amine?
The canonical SMILES for 5-bromo-2,6-dimethylpyrimidin-4-amine is Cc1nc(C)c(Br)c(N)n1.
What is the InChIKey of 5-bromo-2,6-dimethylpyrimidin-4-amine?
The InChIKey is BGFGBTQZFTZLFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8BrN3/c1-3-5(7)6(8)10-4(2)9-3/h1-2H3,(H2,8,9,10).
What are the key properties of 5-bromo-2,6-dimethylpyrimidin-4-amine?
5-bromo-2,6-dimethylpyrimidin-4-amine has a molecular weight of 202.06 g/mol, XLogP of 1.44, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2,6-dimethylpyrimidin-4-amine is sourced from PubChem (CID 608548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).